About 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide
3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 3848951) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide |
| PubChem CID | 3848951 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NN)c1 |
| InChI | InChI=1S/C9H13N3O3S/c1-12(2)16(14,15)8-5-3-4-7(6-8)9(13)11-10/h3-6H,10H2,1-2H3,(H,11,13) |
| InChIKey | PDYSBCAKDARVOS-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide?
The IUPAC name of 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide (CID 3848951) is 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide.
What is the SMILES notation for 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide?
The canonical SMILES for 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide is CN(C)S(=O)(=O)c1cccc(C(=O)NN)c1.
What is the InChIKey of 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide?
The InChIKey is PDYSBCAKDARVOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-12(2)16(14,15)8-5-3-4-7(6-8)9(13)11-10/h3-6H,10H2,1-2H3,(H,11,13).
What are the key properties of 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide?
3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide has a molecular weight of 243.29 g/mol, XLogP of -0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydrazinecarbonyl)-N,N-dimethylbenzenesulfonamide is sourced from PubChem (CID 3848951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).