About 2H-phenanthro[9,10-d]triazole
2H-phenanthro[9,10-d]triazole (PubChem CID 3849420) has the molecular formula C14H9N3
and a molecular weight of 219.25 g/mol. Its IUPAC name is 2H-phenanthro[9,10-d]triazole.
Molecular Properties
| Compound Name | 2H-phenanthro[9,10-d]triazole |
| PubChem CID | 3849420 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2H-phenanthro[9,10-d]triazole |
| SMILES | c1ccc2c(c1)c1ccccc1c1n[nH]nc21 |
| InChI | InChI=1S/C14H9N3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-17-16-14/h1-8H,(H,15,16,17) |
| InChIKey | IUUAERVZHMFZKY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2H-phenanthro[9,10-d]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-phenanthro[9,10-d]triazole?
The IUPAC name of 2H-phenanthro[9,10-d]triazole (CID 3849420) is 2H-phenanthro[9,10-d]triazole.
What is the SMILES notation for 2H-phenanthro[9,10-d]triazole?
The canonical SMILES for 2H-phenanthro[9,10-d]triazole is c1ccc2c(c1)c1ccccc1c1n[nH]nc21.
What is the InChIKey of 2H-phenanthro[9,10-d]triazole?
The InChIKey is IUUAERVZHMFZKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-17-16-14/h1-8H,(H,15,16,17).
What are the key properties of 2H-phenanthro[9,10-d]triazole?
2H-phenanthro[9,10-d]triazole has a molecular weight of 219.25 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-phenanthro[9,10-d]triazole is sourced from PubChem (CID 3849420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).