About 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile
5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile (PubChem CID 3850056) has the molecular formula C12H10ClN3O
and a molecular weight of 247.69 g/mol. Its IUPAC name is 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile |
| PubChem CID | 3850056 |
| Molecular Formula | C12H10ClN3O |
| Molecular Weight | 247.69 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(Oc2cccc(Cl)c2)c1C#N |
| InChI | InChI=1S/C12H10ClN3O/c1-8-11(7-14)12(16(2)15-8)17-10-5-3-4-9(13)6-10/h3-6H,1-2H3 |
| InChIKey | XLPJUAWUNSADIM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile?
The IUPAC name of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile (CID 3850056) is 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile.
What is the SMILES notation for 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile?
The canonical SMILES for 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile is Cc1nn(C)c(Oc2cccc(Cl)c2)c1C#N.
What is the InChIKey of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile?
The InChIKey is XLPJUAWUNSADIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3O/c1-8-11(7-14)12(16(2)15-8)17-10-5-3-4-9(13)6-10/h3-6H,1-2H3.
What are the key properties of 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile?
5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile has a molecular weight of 247.69 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-chlorophenoxy)-1,3-dimethylpyrazole-4-carbonitrile is sourced from PubChem (CID 3850056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).