About N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide
N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide (PubChem CID 38504188) has the molecular formula C19H14F3NO2S
and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide |
| PubChem CID | 38504188 |
| Molecular Formula | C19H14F3NO2S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(NC[C@H](O)c1ccc(F)c(F)c1)c1ccc(-c2ccccc2F)s1 |
| InChI | InChI=1S/C19H14F3NO2S/c20-13-4-2-1-3-12(13)17-7-8-18(26-17)19(25)23-10-16(24)11-5-6-14(21)15(22)9-11/h1-9,16,24H,10H2,(H,23,25)/t16-/m0/s1 |
| InChIKey | OVGHVYBYIDDDBI-INIZCTEOSA-N |
| XLogP | 4.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide?
The IUPAC name of N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide (CID 38504188) is N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide.
What is the SMILES notation for N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide?
The canonical SMILES for N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide is O=C(NC[C@H](O)c1ccc(F)c(F)c1)c1ccc(-c2ccccc2F)s1.
What is the InChIKey of N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide?
The InChIKey is OVGHVYBYIDDDBI-INIZCTEOSA-N. The full InChI is InChI=1S/C19H14F3NO2S/c20-13-4-2-1-3-12(13)17-7-8-18(26-17)19(25)23-10-16(24)11-5-6-14(21)15(22)9-11/h1-9,16,24H,10H2,(H,23,25)/t16-/m0/s1.
What are the key properties of N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide?
N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide has a molecular weight of 377.39 g/mol, XLogP of 4.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-(3,4-difluorophenyl)-2-hydroxyethyl]-5-(2-fluorophenyl)thiophene-2-carboxamide is sourced from PubChem (CID 38504188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).