About S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate
S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate (PubChem CID 3850874) has the molecular formula C8H13NO3S2
and a molecular weight of 235.33 g/mol. Its IUPAC name is S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate.
Molecular Properties
| Compound Name | S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate |
| PubChem CID | 3850874 |
| Molecular Formula | C8H13NO3S2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate |
| SMILES | CC(C)NC(=O)SC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C8H13NO3S2/c1-6(2)9-8(10)13-7-3-4-14(11,12)5-7/h3-4,6-7H,5H2,1-2H3,(H,9,10) |
| InChIKey | PAVIMXQVFLZGEE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate?
The IUPAC name of S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate (CID 3850874) is S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate.
What is the SMILES notation for S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate?
The canonical SMILES for S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate is CC(C)NC(=O)SC1C=CS(=O)(=O)C1.
What is the InChIKey of S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate?
The InChIKey is PAVIMXQVFLZGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3S2/c1-6(2)9-8(10)13-7-3-4-14(11,12)5-7/h3-4,6-7H,5H2,1-2H3,(H,9,10).
What are the key properties of S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate?
S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate has a molecular weight of 235.33 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(1,1-dioxo-2,3-dihydrothiophen-3-yl)] N-propan-2-ylcarbamothioate is sourced from PubChem (CID 3850874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).