C21H21FN4OS — CID 38514229
1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone (PubChem CID 38514229) has the molecular formula C21H21FN4OS and a molecular weight of 396.49 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 38514229 |
| Molecular Formula | C21H21FN4OS |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-2-[(5-phenyl-1H-imidazol-2-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1ncc(-c2ccccc2)[nH]1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H21FN4OS/c22-17-6-8-18(9-7-17)25-10-12-26(13-11-25)20(27)15-28-21-23-14-19(24-21)16-4-2-1-3-5-16/h1-9,14H,10-13,15H2,(H,23,24) |
| InChIKey | NBKZEOIIEACYHF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |