C29H36N2O3 — CID 3852511
1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrrole-3-carboxamide (PubChem CID 3852511) has the molecular formula C29H36N2O3 and a molecular weight of 460.62 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrrole-3-carboxamide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3852511 |
| Molecular Formula | C29H36N2O3 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-2-methyl-5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pyrrole-3-carboxamide |
| SMILES | COc1ccc(Cn2c(-c3ccc4c(c3)C(C)(C)CCC4(C)C)cc(C(N)=O)c2C)cc1OC |
| InChI | InChI=1S/C29H36N2O3/c1-18-21(27(30)32)16-24(31(18)17-19-8-11-25(33-6)26(14-19)34-7)20-9-10-22-23(15-20)29(4,5)13-12-28(22,2)3/h8-11,14-16H,12-13,17H2,1-7H3,(H2,30,32) |
| InChIKey | QPOYRMGYNIPBNM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |