About 1,1,5,5-tetrachloropentane
1,1,5,5-tetrachloropentane (PubChem CID 3852592) has the molecular formula C5H8Cl4
and a molecular weight of 209.93 g/mol. Its IUPAC name is 1,1,5,5-tetrachloropentane.
Molecular Properties
| Compound Name | 1,1,5,5-tetrachloropentane |
| PubChem CID | 3852592 |
| Molecular Formula | C5H8Cl4 |
| Molecular Weight | 209.93 g/mol |
| Exact Mass | 207.94 |
| IUPAC Name | 1,1,5,5-tetrachloropentane |
| SMILES | ClC(Cl)CCCC(Cl)Cl |
| InChI | InChI=1S/C5H8Cl4/c6-4(7)2-1-3-5(8)9/h4-5H,1-3H2 |
| InChIKey | HLBIYQWEHNPODY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,5,5-tetrachloropentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,5,5-tetrachloropentane?
The IUPAC name of 1,1,5,5-tetrachloropentane (CID 3852592) is 1,1,5,5-tetrachloropentane.
What is the SMILES notation for 1,1,5,5-tetrachloropentane?
The canonical SMILES for 1,1,5,5-tetrachloropentane is ClC(Cl)CCCC(Cl)Cl.
What is the InChIKey of 1,1,5,5-tetrachloropentane?
The InChIKey is HLBIYQWEHNPODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8Cl4/c6-4(7)2-1-3-5(8)9/h4-5H,1-3H2.
What are the key properties of 1,1,5,5-tetrachloropentane?
1,1,5,5-tetrachloropentane has a molecular weight of 209.93 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,5,5-tetrachloropentane is sourced from PubChem (CID 3852592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).