C23H27N3O4 — CID 3853869
methyl 3-[4-[2-(benzylamino)-2-oxoethyl]-1,4-diazepane-1-carbonyl]benzoate (PubChem CID 3853869) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is methyl 3-[4-[2-(benzylamino)-2-oxoethyl]-1,4-diazepane-1-carbonyl]benzoate.
| Compound Name | methyl 3-[4-[2-(benzylamino)-2-oxoethyl]-1,4-diazepane-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 3853869 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | methyl 3-[4-[2-(benzylamino)-2-oxoethyl]-1,4-diazepane-1-carbonyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)N2CCCN(CC(=O)NCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-30-23(29)20-10-5-9-19(15-20)22(28)26-12-6-11-25(13-14-26)17-21(27)24-16-18-7-3-2-4-8-18/h2-5,7-10,15H,6,11-14,16-17H2,1H3,(H,24,27) |
| InChIKey | TWZFRACAJRKLJO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |