C16H16FNO4S — CID 3854350
methyl 2-[(3-fluorophenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 3854350) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is methyl 2-[(3-fluorophenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[(3-fluorophenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 3854350 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | methyl 2-[(3-fluorophenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H16FNO4S/c1-22-16(19)15(10-12-6-3-2-4-7-12)18-23(20,21)14-9-5-8-13(17)11-14/h2-9,11,15,18H,10H2,1H3 |
| InChIKey | JJGLNMXIQRLVHY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |