About 2-cyano-N,N-diethylacetamide
2-cyano-N,N-diethylacetamide (PubChem CID 3854515) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-cyano-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-cyano-N,N-diethylacetamide |
| PubChem CID | 3854515 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-cyano-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC#N |
| InChI | InChI=1S/C7H12N2O/c1-3-9(4-2)7(10)5-6-8/h3-5H2,1-2H3 |
| InChIKey | RYSHIRFTLKZVIH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N,N-diethylacetamide?
The IUPAC name of 2-cyano-N,N-diethylacetamide (CID 3854515) is 2-cyano-N,N-diethylacetamide.
What is the SMILES notation for 2-cyano-N,N-diethylacetamide?
The canonical SMILES for 2-cyano-N,N-diethylacetamide is CCN(CC)C(=O)CC#N.
What is the InChIKey of 2-cyano-N,N-diethylacetamide?
The InChIKey is RYSHIRFTLKZVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-9(4-2)7(10)5-6-8/h3-5H2,1-2H3.
What are the key properties of 2-cyano-N,N-diethylacetamide?
2-cyano-N,N-diethylacetamide has a molecular weight of 140.19 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N,N-diethylacetamide is sourced from PubChem (CID 3854515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).