C10H9ClN2O2 — CID 3854691
N-(3-chloro-4-methoxyphenyl)-2-cyanoacetamide (PubChem CID 3854691) has the molecular formula C10H9ClN2O2 and a molecular weight of 224.65 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-cyanoacetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-cyanoacetamide |
|---|---|
| PubChem CID | 3854691 |
| Molecular Formula | C10H9ClN2O2 |
| Molecular Weight | 224.65 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-cyanoacetamide |
| SMILES | COc1ccc(NC(=O)CC#N)cc1Cl |
| InChI | InChI=1S/C10H9ClN2O2/c1-15-9-3-2-7(6-8(9)11)13-10(14)4-5-12/h2-3,6H,4H2,1H3,(H,13,14) |
| InChIKey | LVBZGBGZBJPXKO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |