C19H17F3N6O2S3 — CID 3854904
2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(prop-2-enylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide (PubChem CID 3854904) has the molecular formula C19H17F3N6O2S3 and a molecular weight of 514.58 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(prop-2-enylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(prop-2-enylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3854904 |
| Molecular Formula | C19H17F3N6O2S3 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(prop-2-enylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide |
| SMILES | C=CCNC(=S)n1nc(-c2ccccc2NC(=O)C(F)(F)F)c(=O)n(C(=S)NCC=C)c1=S |
| InChI | InChI=1S/C19H17F3N6O2S3/c1-3-9-23-16(31)27-14(29)13(26-28(18(27)33)17(32)24-10-4-2)11-7-5-6-8-12(11)25-15(30)19(20,21)22/h3-8H,1-2,9-10H2,(H,23,31)(H,24,32)(H,25,30) |
| InChIKey | PCANEFVQVFCLIV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|