About N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide
N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide (PubChem CID 38549752) has the molecular formula C13H13FN2O
and a molecular weight of 232.26 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide |
| PubChem CID | 38549752 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2F)n1C |
| InChI | InChI=1S/C13H13FN2O/c1-9-7-8-12(16(9)2)13(17)15-11-6-4-3-5-10(11)14/h3-8H,1-2H3,(H,15,17) |
| InChIKey | JNELFJCBMXBIEF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide?
The IUPAC name of N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide (CID 38549752) is N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide.
What is the SMILES notation for N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide?
The canonical SMILES for N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide is Cc1ccc(C(=O)Nc2ccccc2F)n1C.
What is the InChIKey of N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide?
The InChIKey is JNELFJCBMXBIEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O/c1-9-7-8-12(16(9)2)13(17)15-11-6-4-3-5-10(11)14/h3-8H,1-2H3,(H,15,17).
What are the key properties of N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide?
N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide has a molecular weight of 232.26 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorophenyl)-1,5-dimethylpyrrole-2-carboxamide is sourced from PubChem (CID 38549752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).