C22H27N7O4S — CID 3854993
N-(4-amino-4-oxobutyl)-3-[(3-methylsulfanylphenyl)carbamoylamino]-1-(pyrazine-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 3854993) has the molecular formula C22H27N7O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-3-[(3-methylsulfanylphenyl)carbamoylamino]-1-(pyrazine-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(4-amino-4-oxobutyl)-3-[(3-methylsulfanylphenyl)carbamoylamino]-1-(pyrazine-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 3854993 |
| Molecular Formula | C22H27N7O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-3-[(3-methylsulfanylphenyl)carbamoylamino]-1-(pyrazine-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CSc1cccc(NC(=O)NC2CCN(C(=O)c3cnccn3)C2C(=O)NCCCC(N)=O)c1 |
| InChI | InChI=1S/C22H27N7O4S/c1-34-15-5-2-4-14(12-15)27-22(33)28-16-7-11-29(21(32)17-13-24-9-10-25-17)19(16)20(31)26-8-3-6-18(23)30/h2,4-5,9-10,12-13,16,19H,3,6-8,11H2,1H3,(H2,23,30)(H,26,31)(H2,27,28,33) |
| InChIKey | GEWFPGAGKDJMHH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|