C11H14N2S — CID 3856622
N-(1-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 3856622) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is N-(1-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(1-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3856622 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-(1-phenylethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC(NC1=NCCS1)c1ccccc1 |
| InChI | InChI=1S/C11H14N2S/c1-9(10-5-3-2-4-6-10)13-11-12-7-8-14-11/h2-6,9H,7-8H2,1H3,(H,12,13) |
| InChIKey | JXFZUEXOEBPBHP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |