C24H37N3O — CID 3857182
4-cycloheptyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]piperazine-1-carboxamide (PubChem CID 3857182) has the molecular formula C24H37N3O and a molecular weight of 383.58 g/mol. Its IUPAC name is 4-cycloheptyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-cycloheptyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 3857182 |
| Molecular Formula | C24H37N3O |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 4-cycloheptyl-N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]piperazine-1-carboxamide |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)N2CCN(C3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H37N3O/c1-19(2)20-10-9-11-21(18-20)24(3,4)25-23(28)27-16-14-26(15-17-27)22-12-7-5-6-8-13-22/h9-11,18,22H,1,5-8,12-17H2,2-4H3,(H,25,28) |
| InChIKey | WBOHDRFLZCEXNT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |