C24H29FN6O4 — CID 3857271
3-[[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methyl]-6-(dimethylamino)-2-fluorobenzonitrile (PubChem CID 3857271) has the molecular formula C24H29FN6O4 and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-[[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methyl]-6-(dimethylamino)-2-fluorobenzonitrile.
| Compound Name | 3-[[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methyl]-6-(dimethylamino)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 3857271 |
| Molecular Formula | C24H29FN6O4 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | 3-[[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methyl]-6-(dimethylamino)-2-fluorobenzonitrile |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(Cc3ccc(N(C)C)c(C#N)c3F)CCO2)n1 |
| InChI | InChI=1S/C24H29FN6O4/c1-5-10-33-22-27-23(34-11-6-2)29-24(28-22)35-16-18-15-31(9-12-32-18)14-17-7-8-20(30(3)4)19(13-26)21(17)25/h5-8,18H,1-2,9-12,14-16H2,3-4H3 |
| InChIKey | DTSAHQNDRMUNFK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 105.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|