C24H26N2O3S — CID 38573949
[4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 38573949) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38573949 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [4-(4-methoxyphenyl)-5-methylthiophen-2-yl]-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCN(c4cccc(OC)c4)CC3)sc2C)cc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-17-22(18-7-9-20(28-2)10-8-18)16-23(30-17)24(27)26-13-11-25(12-14-26)19-5-4-6-21(15-19)29-3/h4-10,15-16H,11-14H2,1-3H3 |
| InChIKey | CLAXFMUBEOUSFO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |