C27H26N4O2 — CID 38574762
(1,3-diphenylpyrazol-4-yl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 38574762) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (1,3-diphenylpyrazol-4-yl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38574762 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)-[4-(3-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1cccc(N2CCN(C(=O)c3cn(-c4ccccc4)nc3-c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C27H26N4O2/c1-33-24-14-8-13-23(19-24)29-15-17-30(18-16-29)27(32)25-20-31(22-11-6-3-7-12-22)28-26(25)21-9-4-2-5-10-21/h2-14,19-20H,15-18H2,1H3 |
| InChIKey | RKPTUDSVNFBSGB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |