C24H23N3O4S — CID 38580200
4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-methyl-N-(3-phenoxypropyl)benzamide (PubChem CID 38580200) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-methyl-N-(3-phenoxypropyl)benzamide.
| Compound Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-methyl-N-(3-phenoxypropyl)benzamide |
|---|---|
| PubChem CID | 38580200 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]-N-methyl-N-(3-phenoxypropyl)benzamide |
| SMILES | CN(CCCOc1ccccc1)C(=O)c1ccc(NC2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H23N3O4S/c1-27(16-7-17-31-20-8-3-2-4-9-20)24(28)18-12-14-19(15-13-18)25-23-21-10-5-6-11-22(21)32(29,30)26-23/h2-6,8-15H,7,16-17H2,1H3,(H,25,26) |
| InChIKey | RMMVEFUJORLAKB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|