C17H18BrN3O4 — CID 38583856
N-[2-[3-[[acetyl(methyl)amino]methyl]anilino]-2-oxoethyl]-5-bromofuran-2-carboxamide (PubChem CID 38583856) has the molecular formula C17H18BrN3O4 and a molecular weight of 408.25 g/mol. Its IUPAC name is N-[2-[3-[[acetyl(methyl)amino]methyl]anilino]-2-oxoethyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[2-[3-[[acetyl(methyl)amino]methyl]anilino]-2-oxoethyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 38583856 |
| Molecular Formula | C17H18BrN3O4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | N-[2-[3-[[acetyl(methyl)amino]methyl]anilino]-2-oxoethyl]-5-bromofuran-2-carboxamide |
| SMILES | CC(=O)N(C)Cc1cccc(NC(=O)CNC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C17H18BrN3O4/c1-11(22)21(2)10-12-4-3-5-13(8-12)20-16(23)9-19-17(24)14-6-7-15(18)25-14/h3-8H,9-10H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | DGDBONOGABJOQH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |