About 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide (PubChem CID 38585265) has the molecular formula C16H28N4O3
and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide.
Molecular Properties
| Compound Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide |
| PubChem CID | 38585265 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide |
| SMILES | C[C@@H](CNC(=O)CCc1nc(C(C)(C)C)no1)N1CCOCC1 |
| InChI | InChI=1S/C16H28N4O3/c1-12(20-7-9-22-10-8-20)11-17-13(21)5-6-14-18-15(19-23-14)16(2,3)4/h12H,5-11H2,1-4H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | MMUNKLAQRUIJGK-LBPRGKRZSA-N |
| XLogP | 1.14 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide?
The IUPAC name of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide (CID 38585265) is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide.
What is the SMILES notation for 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide?
The canonical SMILES for 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide is C[C@@H](CNC(=O)CCc1nc(C(C)(C)C)no1)N1CCOCC1.
What is the InChIKey of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide?
The InChIKey is MMUNKLAQRUIJGK-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H28N4O3/c1-12(20-7-9-22-10-8-20)11-17-13(21)5-6-14-18-15(19-23-14)16(2,3)4/h12H,5-11H2,1-4H3,(H,17,21)/t12-/m0/s1.
What are the key properties of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide?
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide has a molecular weight of 324.43 g/mol, XLogP of 1.14, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[(2S)-2-morpholin-4-ylpropyl]propanamide is sourced from PubChem (CID 38585265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).