C22H22ClN3O5 — CID 3858600
2-[5-(3-chloro-4-methylphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide (PubChem CID 3858600) has the molecular formula C22H22ClN3O5 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-[5-(3-chloro-4-methylphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide.
| Compound Name | 2-[5-(3-chloro-4-methylphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3858600 |
| Molecular Formula | C22H22ClN3O5 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[5-(3-chloro-4-methylphenyl)-3-(4-hydroxy-3,5-dimethylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3ON(CC(N)=O)C(c4cc(C)c(O)c(C)c4)C3C2=O)cc1Cl |
| InChI | InChI=1S/C22H22ClN3O5/c1-10-4-5-14(8-15(10)23)26-21(29)17-18(13-6-11(2)19(28)12(3)7-13)25(9-16(24)27)31-20(17)22(26)30/h4-8,17-18,20,28H,9H2,1-3H3,(H2,24,27) |
| InChIKey | COPXXANCCKRLQI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|