C27H37N3O4S2 — CID 3858727
2-[5-hydroxy-4,8a-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide (PubChem CID 3858727) has the molecular formula C27H37N3O4S2 and a molecular weight of 531.74 g/mol. Its IUPAC name is 2-[5-hydroxy-4,8a-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide.
| Compound Name | 2-[5-hydroxy-4,8a-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 3858727 |
| Molecular Formula | C27H37N3O4S2 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 2-[5-hydroxy-4,8a-dimethyl-2-[(4-methylphenyl)sulfonylamino]-4a,5,6,7,8,9-hexahydro-4H-benzo[f][1,3]benzothiazol-6-yl]-N-methyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C)C(=O)C(C)C1CCC2(C)Cc3sc(NS(=O)(=O)c4ccc(C)cc4)nc3C(C)C2C1O |
| InChI | InChI=1S/C27H37N3O4S2/c1-7-14-30(6)25(32)17(3)20-12-13-27(5)15-21-23(18(4)22(27)24(20)31)28-26(35-21)29-36(33,34)19-10-8-16(2)9-11-19/h7-11,17-18,20,22,24,31H,1,12-15H2,2-6H3,(H,28,29) |
| InChIKey | SZJVBPRPFPMLOG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|