About 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide
4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 3858834) has the molecular formula C11H6Br2ClF2NO2S2
and a molecular weight of 481.57 g/mol. Its IUPAC name is 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide |
| PubChem CID | 3858834 |
| Molecular Formula | C11H6Br2ClF2NO2S2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 478.79 |
| IUPAC Name | 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1c(F)ccc(Cl)c1F)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H6Br2ClF2NO2S2/c12-6-3-9(20-11(6)13)21(18,19)17-4-5-8(15)2-1-7(14)10(5)16/h1-3,17H,4H2 |
| InChIKey | WDLXMSJWNKKOHD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide?
The IUPAC name of 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide (CID 3858834) is 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide.
What is the SMILES notation for 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide?
The canonical SMILES for 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide is O=S(=O)(NCc1c(F)ccc(Cl)c1F)c1cc(Br)c(Br)s1.
What is the InChIKey of 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide?
The InChIKey is WDLXMSJWNKKOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Br2ClF2NO2S2/c12-6-3-9(20-11(6)13)21(18,19)17-4-5-8(15)2-1-7(14)10(5)16/h1-3,17H,4H2.
What are the key properties of 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide?
4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide has a molecular weight of 481.57 g/mol, XLogP of 4.68, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibromo-N-[(3-chloro-2,6-difluorophenyl)methyl]thiophene-2-sulfonamide is sourced from PubChem (CID 3858834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).