C6H5F9N2O2 — CID 3858843
3,3,4,4,5,5,6,6,6-nonafluoro-1-nitrohexan-2-amine (PubChem CID 3858843) has the molecular formula C6H5F9N2O2 and a molecular weight of 308.10 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluoro-1-nitrohexan-2-amine.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluoro-1-nitrohexan-2-amine |
|---|---|
| PubChem CID | 3858843 |
| Molecular Formula | C6H5F9N2O2 |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluoro-1-nitrohexan-2-amine |
| SMILES | NC(C[N+](=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9N2O2/c7-3(8,2(16)1-17(18)19)4(9,10)5(11,12)6(13,14)15/h2H,1,16H2 |
| InChIKey | VUUHRNJMJYYARH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|