About 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one
5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one (PubChem CID 3860435) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one |
| PubChem CID | 3860435 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one |
| SMILES | C=C1CCC2C(CC2(C)C)C(=O)CCC1O |
| InChI | InChI=1S/C14H22O2/c1-9-4-5-11-10(8-14(11,2)3)13(16)7-6-12(9)15/h10-12,15H,1,4-8H2,2-3H3 |
| InChIKey | BSFUDCIRZBAPDS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one?
The IUPAC name of 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one (CID 3860435) is 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one.
What is the SMILES notation for 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one?
The canonical SMILES for 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one is C=C1CCC2C(CC2(C)C)C(=O)CCC1O.
What is the InChIKey of 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one?
The InChIKey is BSFUDCIRZBAPDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-9-4-5-11-10(8-14(11,2)3)13(16)7-6-12(9)15/h10-12,15H,1,4-8H2,2-3H3.
What are the key properties of 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one?
5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one has a molecular weight of 222.33 g/mol, XLogP of 2.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-10,10-dimethyl-6-methylidenebicyclo[7.2.0]undecan-2-one is sourced from PubChem (CID 3860435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).