C26H30N6O4S — CID 3861406
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-6-methyl-2-[1-[2-(3-nitrophenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 3861406) has the molecular formula C26H30N6O4S and a molecular weight of 522.63 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-6-methyl-2-[1-[2-(3-nitrophenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-6-methyl-2-[1-[2-(3-nitrophenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3861406 |
| Molecular Formula | C26H30N6O4S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-6-methyl-2-[1-[2-(3-nitrophenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(C(C)(C)C)s2)c(C2CCN(C(=O)Cc3cccc([N+](=O)[O-])c3)CC2)n1 |
| InChI | InChI=1S/C26H30N6O4S/c1-16-8-9-20(23(34)28-25-30-29-24(37-25)26(2,3)4)22(27-16)18-10-12-31(13-11-18)21(33)15-17-6-5-7-19(14-17)32(35)36/h5-9,14,18H,10-13,15H2,1-4H3,(H,28,30,34) |
| InChIKey | MTTGXYLVBMJZGA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|