About ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate
ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate (PubChem CID 3861830) has the molecular formula C17H29N3O4S
and a molecular weight of 371.50 g/mol. Its IUPAC name is ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate |
| PubChem CID | 3861830 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=S)N1CCC(N2C(=O)OCC2CC)CC1 |
| InChI | InChI=1S/C17H29N3O4S/c1-3-13-12-24-17(22)20(13)14-7-10-19(11-8-14)16(25)18-9-5-6-15(21)23-4-2/h13-14H,3-12H2,1-2H3,(H,18,25) |
| InChIKey | SURSLABCTZMEQG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate?
The IUPAC name of ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate (CID 3861830) is ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate.
What is the SMILES notation for ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate?
The canonical SMILES for ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate is CCOC(=O)CCCNC(=S)N1CCC(N2C(=O)OCC2CC)CC1.
What is the InChIKey of ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate?
The InChIKey is SURSLABCTZMEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O4S/c1-3-13-12-24-17(22)20(13)14-7-10-19(11-8-14)16(25)18-9-5-6-15(21)23-4-2/h13-14H,3-12H2,1-2H3,(H,18,25).
What are the key properties of ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate?
ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate has a molecular weight of 371.50 g/mol, XLogP of 1.90, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[4-(4-ethyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioyl]amino]butanoate is sourced from PubChem (CID 3861830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).