About 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine
1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine (PubChem CID 3862176) has the molecular formula C10H11BrCl2N2O2S
and a molecular weight of 374.09 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine.
Molecular Properties
| Compound Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine |
| PubChem CID | 3862176 |
| Molecular Formula | C10H11BrCl2N2O2S |
| Molecular Weight | 374.09 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine |
| SMILES | O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C10H11BrCl2N2O2S/c11-7-5-8(12)10(9(13)6-7)18(16,17)15-3-1-14-2-4-15/h5-6,14H,1-4H2 |
| InChIKey | YEOHRRUXVXSYRN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine?
The IUPAC name of 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine (CID 3862176) is 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine.
What is the SMILES notation for 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine?
The canonical SMILES for 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine is O=S(=O)(c1c(Cl)cc(Br)cc1Cl)N1CCNCC1.
What is the InChIKey of 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine?
The InChIKey is YEOHRRUXVXSYRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrCl2N2O2S/c11-7-5-8(12)10(9(13)6-7)18(16,17)15-3-1-14-2-4-15/h5-6,14H,1-4H2.
What are the key properties of 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine?
1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine has a molecular weight of 374.09 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,6-dichlorophenyl)sulfonylpiperazine is sourced from PubChem (CID 3862176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).