C22H24N2O3 — CID 3862274
1-[2-(2,5-dimethoxyphenyl)ethyl]-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 3862274) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)ethyl]-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3862274 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | COc1ccc(OC)c(CCn2c(-c3ccccc3)cc(C(N)=O)c2C)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-15-19(22(23)25)14-20(16-7-5-4-6-8-16)24(15)12-11-17-13-18(26-2)9-10-21(17)27-3/h4-10,13-14H,11-12H2,1-3H3,(H2,23,25) |
| InChIKey | LJRQQUYTRZRUOV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |