C29H30N4O2S — CID 3862421
N-(1-benzylpyrrolidin-3-yl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 3862421) has the molecular formula C29H30N4O2S and a molecular weight of 498.65 g/mol. Its IUPAC name is N-(1-benzylpyrrolidin-3-yl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1-benzylpyrrolidin-3-yl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3862421 |
| Molecular Formula | C29H30N4O2S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-(1-benzylpyrrolidin-3-yl)-2-[1-(3-phenylprop-2-ynoyl)piperidin-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)C1)c1csc(C2CCN(C(=O)C#Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C29H30N4O2S/c34-27(12-11-22-7-3-1-4-8-22)33-17-13-24(14-18-33)29-31-26(21-36-29)28(35)30-25-15-16-32(20-25)19-23-9-5-2-6-10-23/h1-10,21,24-25H,13-20H2,(H,30,35) |
| InChIKey | OOWWTEMVERCTKW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|