About 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide
4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (PubChem CID 3862719) has the molecular formula C14H17N3O3S
and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| PubChem CID | 3862719 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)Nc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-9-14(10(2)17(4)15-9)16-21(19,20)13-7-5-12(6-8-13)11(3)18/h5-8,16H,1-4H3 |
| InChIKey | MMXLEVZJONKLRG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The IUPAC name of 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide (CID 3862719) is 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide.
What is the SMILES notation for 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The canonical SMILES for 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide is CC(=O)c1ccc(S(=O)(=O)Nc2c(C)nn(C)c2C)cc1.
What is the InChIKey of 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
The InChIKey is MMXLEVZJONKLRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3S/c1-9-14(10(2)17(4)15-9)16-21(19,20)13-7-5-12(6-8-13)11(3)18/h5-8,16H,1-4H3.
What are the key properties of 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide?
4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide has a molecular weight of 307.38 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-N-(1,3,5-trimethylpyrazol-4-yl)benzenesulfonamide is sourced from PubChem (CID 3862719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).