About 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide
5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide (PubChem CID 38633334) has the molecular formula C19H15BrN2O4S2
and a molecular weight of 479.38 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide |
| PubChem CID | 38633334 |
| Molecular Formula | C19H15BrN2O4S2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NNC(=O)c2ccc(-c3ccc(Br)cc3)s2)cc1 |
| InChI | InChI=1S/C19H15BrN2O4S2/c1-28(25,26)15-8-4-13(5-9-15)18(23)21-22-19(24)17-11-10-16(27-17)12-2-6-14(20)7-3-12/h2-11H,1H3,(H,21,23)(H,22,24) |
| InChIKey | KUXAGYGMGQJIHA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide?
The IUPAC name of 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide (CID 38633334) is 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide.
What is the SMILES notation for 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide?
The canonical SMILES for 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide is CS(=O)(=O)c1ccc(C(=O)NNC(=O)c2ccc(-c3ccc(Br)cc3)s2)cc1.
What is the InChIKey of 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide?
The InChIKey is KUXAGYGMGQJIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrN2O4S2/c1-28(25,26)15-8-4-13(5-9-15)18(23)21-22-19(24)17-11-10-16(27-17)12-2-6-14(20)7-3-12/h2-11H,1H3,(H,21,23)(H,22,24).
What are the key properties of 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide?
5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide has a molecular weight of 479.38 g/mol, XLogP of 3.66, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-N'-(4-methylsulfonylbenzoyl)thiophene-2-carbohydrazide is sourced from PubChem (CID 38633334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).