C10H10Cl2N2S — CID 3863745
N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 3863745) has the molecular formula C10H10Cl2N2S and a molecular weight of 261.18 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 3863745 |
| Molecular Formula | C10H10Cl2N2S |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | Clc1ccc(NC2=NCCCS2)cc1Cl |
| InChI | InChI=1S/C10H10Cl2N2S/c11-8-3-2-7(6-9(8)12)14-10-13-4-1-5-15-10/h2-3,6H,1,4-5H2,(H,13,14) |
| InChIKey | CXSKSYHKTWRGRM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |