C24H19F5N4O4 — CID 3864016
2-(2-nitrophenoxy)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 3864016) has the molecular formula C24H19F5N4O4 and a molecular weight of 522.43 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3864016 |
| Molecular Formula | C24H19F5N4O4 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C24H19F5N4O4/c25-19-20(26)22(28)24(23(29)21(19)27)32-11-9-31(10-12-32)15-7-5-14(6-8-15)30-18(34)13-37-17-4-2-1-3-16(17)33(35)36/h1-8H,9-13H2,(H,30,34) |
| InChIKey | VCGFOWHTXWVFPA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|