C29H27N3O5 — CID 38645004
1-[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide (PubChem CID 38645004) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is 1-[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38645004 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 1-[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]-N-(2-methoxyphenyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1NC(=O)C1CCN(C(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)CC1 |
| InChI | InChI=1S/C29H27N3O5/c1-37-25-9-5-4-8-24(25)30-26(33)20-14-16-31(17-15-20)27(34)21-12-10-19(11-13-21)18-32-28(35)22-6-2-3-7-23(22)29(32)36/h2-13,20H,14-18H2,1H3,(H,30,33) |
| InChIKey | ZNUWHHHAHIZZPP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|