C28H40N4O2S — CID 3865134
N-(2-ethylhexyl)-5-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide (PubChem CID 3865134) has the molecular formula C28H40N4O2S and a molecular weight of 496.72 g/mol. Its IUPAC name is N-(2-ethylhexyl)-5-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | N-(2-ethylhexyl)-5-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3865134 |
| Molecular Formula | C28H40N4O2S |
| Molecular Weight | 496.72 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | N-(2-ethylhexyl)-5-[2-(2-ethyl-4-pyridinyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxamide |
| SMILES | CCCCC(CC)CNC(=O)c1cc(-c2csc(-c3ccnc(CC)c3)n2)n(CCCOC)c1C |
| InChI | InChI=1S/C28H40N4O2S/c1-6-9-11-21(7-2)18-30-27(33)24-17-26(32(20(24)4)14-10-15-34-5)25-19-35-28(31-25)22-12-13-29-23(8-3)16-22/h12-13,16-17,19,21H,6-11,14-15,18H2,1-5H3,(H,30,33) |
| InChIKey | NDXXAFCHWVVPOX-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.72 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|