C14H22N4O5S — CID 3865250
1-[3-(2-methylsulfonylethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-prop-2-enylurea (PubChem CID 3865250) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[3-(2-methylsulfonylethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-prop-2-enylurea.
| Compound Name | 1-[3-(2-methylsulfonylethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 3865250 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-[3-(2-methylsulfonylethyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-8-yl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)NC1CCN2C(=O)C(CCS(C)(=O)=O)NC(=O)C12 |
| InChI | InChI=1S/C14H22N4O5S/c1-3-6-15-14(21)17-9-4-7-18-11(9)12(19)16-10(13(18)20)5-8-24(2,22)23/h3,9-11H,1,4-8H2,2H3,(H,16,19)(H2,15,17,21) |
| InChIKey | CPSLJIFPUOBRRV-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|