C13H14F3N3O3 — CID 38652523
5,5-dimethyl-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]imidazolidine-2,4-dione (PubChem CID 38652523) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 38652523 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 5,5-dimethyl-3-[2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]ethyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCn2cc(C(F)(F)F)ccc2=O)C1=O |
| InChI | InChI=1S/C13H14F3N3O3/c1-12(2)10(21)19(11(22)17-12)6-5-18-7-8(13(14,15)16)3-4-9(18)20/h3-4,7H,5-6H2,1-2H3,(H,17,22) |
| InChIKey | NFYGMLVLMXJPMT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|