2-amino-2-phenylacetic acid

C8H9NO2 — CID 3866

IUPAC2-amino-2-phenylacetic acid
SMILESNC(C(=O)O)c1ccccc1
InChIInChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)
InChIKeyZGUNAGUHMKGQNY-UHFFFAOYSA-N
MW151.16 g/mol
LogP0.77
Rot. Bonds2

About 2-amino-2-phenylacetic acid

2-amino-2-phenylacetic acid (PubChem CID 3866) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-amino-2-phenylacetic acid.

Molecular Properties

Compound Name2-amino-2-phenylacetic acid
PubChem CID3866
Molecular FormulaC8H9NO2
Molecular Weight151.16 g/mol
Exact Mass151.06
IUPAC Name2-amino-2-phenylacetic acid
SMILESNC(C(=O)O)c1ccccc1
InChIInChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11)
InChIKeyZGUNAGUHMKGQNY-UHFFFAOYSA-N
XLogP0.77
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.16
LogP ≤ 50.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-phenylacetic acid?
The IUPAC name of 2-amino-2-phenylacetic acid (CID 3866) is 2-amino-2-phenylacetic acid.
What is the SMILES notation for 2-amino-2-phenylacetic acid?
The canonical SMILES for 2-amino-2-phenylacetic acid is NC(C(=O)O)c1ccccc1.
What is the InChIKey of 2-amino-2-phenylacetic acid?
The InChIKey is ZGUNAGUHMKGQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11).
What are the key properties of 2-amino-2-phenylacetic acid?
2-amino-2-phenylacetic acid has a molecular weight of 151.16 g/mol, XLogP of 0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-phenylacetic acid is sourced from PubChem (CID 3866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).