C25H25N3O4 — CID 38668542
(3R)-1-(4-ethoxyphenyl)-5-oxo-N-[3-(pyridin-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide (PubChem CID 38668542) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (3R)-1-(4-ethoxyphenyl)-5-oxo-N-[3-(pyridin-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(4-ethoxyphenyl)-5-oxo-N-[3-(pyridin-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 38668542 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (3R)-1-(4-ethoxyphenyl)-5-oxo-N-[3-(pyridin-2-ylmethoxy)phenyl]pyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(N2C[C@H](C(=O)Nc3cccc(OCc4ccccn4)c3)CC2=O)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-2-31-22-11-9-21(10-12-22)28-16-18(14-24(28)29)25(30)27-19-7-5-8-23(15-19)32-17-20-6-3-4-13-26-20/h3-13,15,18H,2,14,16-17H2,1H3,(H,27,30)/t18-/m1/s1 |
| InChIKey | SGOKKSGDUDKFJV-GOSISDBHSA-N |
| XLogP | 4.05 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |