C14H17FN4OS — CID 38669119
4-cyclopropyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 38669119) has the molecular formula C14H17FN4OS and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-cyclopropyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-cyclopropyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 38669119 |
| Molecular Formula | C14H17FN4OS |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 4-cyclopropyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | Nc1nnc(SCCCOc2ccc(F)cc2)n1C1CC1 |
| InChI | InChI=1S/C14H17FN4OS/c15-10-2-6-12(7-3-10)20-8-1-9-21-14-18-17-13(16)19(14)11-4-5-11/h2-3,6-7,11H,1,4-5,8-9H2,(H2,16,17) |
| InChIKey | PTXIEKRZWDIDPN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|