C28H34N3O4+ — CID 3867939
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl]ethanone (PubChem CID 3867939) has the molecular formula C28H34N3O4+ and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl]ethanone.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 3867939 |
| Molecular Formula | C28H34N3O4+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[3-[(5-methyl-2-propan-2-ylphenoxy)methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-4-ium-1-yl]ethanone |
| SMILES | Cc1ccc(C(C)C)c(OCc2nn(CC(=O)c3ccc4c(c3)OCCO4)c3[n+]2CCCCC3)c1 |
| InChI | InChI=1S/C28H34N3O4/c1-19(2)22-10-8-20(3)15-25(22)35-18-27-29-31(28-7-5-4-6-12-30(27)28)17-23(32)21-9-11-24-26(16-21)34-14-13-33-24/h8-11,15-16,19H,4-7,12-14,17-18H2,1-3H3/q+1 |
| InChIKey | JNNZOFHRJZVCQS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|