C14H25N3O3 — CID 3868124
2-(1-amino-2-hydroxypropyl)-N-heptyl-1,3-oxazole-4-carboxamide (PubChem CID 3868124) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(1-amino-2-hydroxypropyl)-N-heptyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-hydroxypropyl)-N-heptyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3868124 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-(1-amino-2-hydroxypropyl)-N-heptyl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCCCNC(=O)c1coc(C(N)C(C)O)n1 |
| InChI | InChI=1S/C14H25N3O3/c1-3-4-5-6-7-8-16-13(19)11-9-20-14(17-11)12(15)10(2)18/h9-10,12,18H,3-8,15H2,1-2H3,(H,16,19) |
| InChIKey | FZGHUEWEXBTZKG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|