C25H26N4O6 — CID 3868866
[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone (PubChem CID 3868866) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is [8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone.
| Compound Name | [8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 3868866 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decan-2-yl]-[5-(2-nitrophenyl)furan-2-yl]methanone |
| SMILES | Cc1noc(C)c1C(=O)N1CCC2(CCN(C(=O)c3ccc(-c4ccccc4[N+](=O)[O-])o3)C2)CC1 |
| InChI | InChI=1S/C25H26N4O6/c1-16-22(17(2)35-26-16)24(31)27-12-9-25(10-13-27)11-14-28(15-25)23(30)21-8-7-20(34-21)18-5-3-4-6-19(18)29(32)33/h3-8H,9-15H2,1-2H3 |
| InChIKey | KFYVHSNSHQJXLJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 122.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|