C23H26N4O7 — CID 3868868
methyl 3-[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-5-nitrobenzoate (PubChem CID 3868868) has the molecular formula C23H26N4O7 and a molecular weight of 470.48 g/mol. Its IUPAC name is methyl 3-[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-5-nitrobenzoate.
| Compound Name | methyl 3-[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 3868868 |
| Molecular Formula | C23H26N4O7 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | methyl 3-[8-(3,5-dimethyl-1,2-oxazole-4-carbonyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N2CCC3(CCN(C(=O)c4c(C)noc4C)CC3)C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H26N4O7/c1-14-19(15(2)34-24-14)21(29)25-7-4-23(5-8-25)6-9-26(13-23)20(28)16-10-17(22(30)33-3)12-18(11-16)27(31)32/h10-12H,4-9,13H2,1-3H3 |
| InChIKey | PBLISIFMPALIRY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 136.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|