About 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione
2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione (PubChem CID 3869812) has the molecular formula C28H19NO2
and a molecular weight of 401.47 g/mol. Its IUPAC name is 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione.
Molecular Properties
| Compound Name | 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione |
| PubChem CID | 3869812 |
| Molecular Formula | C28H19NO2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione |
| SMILES | O=C(CC(C(=O)c1ccccc1)=C1c2ccccc2-c2ncccc21)c1ccccc1 |
| InChI | InChI=1S/C28H19NO2/c30-25(19-10-3-1-4-11-19)18-24(28(31)20-12-5-2-6-13-20)26-21-14-7-8-15-22(21)27-23(26)16-9-17-29-27/h1-17H,18H2 |
| InChIKey | DXTFXQKEQHMRMB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione?
The IUPAC name of 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione (CID 3869812) is 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione.
What is the SMILES notation for 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione?
The canonical SMILES for 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione is O=C(CC(C(=O)c1ccccc1)=C1c2ccccc2-c2ncccc21)c1ccccc1.
What is the InChIKey of 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione?
The InChIKey is DXTFXQKEQHMRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H19NO2/c30-25(19-10-3-1-4-11-19)18-24(28(31)20-12-5-2-6-13-20)26-21-14-7-8-15-22(21)27-23(26)16-9-17-29-27/h1-17H,18H2.
What are the key properties of 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione?
2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione has a molecular weight of 401.47 g/mol, XLogP of 6.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-indeno[1,2-b]pyridin-5-ylidene-1,4-diphenylbutane-1,4-dione is sourced from PubChem (CID 3869812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).