About S-(4-methylphenyl) propanethioate
S-(4-methylphenyl) propanethioate (PubChem CID 3870745) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is S-(4-methylphenyl) propanethioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) propanethioate |
| PubChem CID | 3870745 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | S-(4-methylphenyl) propanethioate |
| SMILES | CCC(=O)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C10H12OS/c1-3-10(11)12-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
| InChIKey | QCOJPGJASADAIQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) propanethioate?
The IUPAC name of S-(4-methylphenyl) propanethioate (CID 3870745) is S-(4-methylphenyl) propanethioate.
What is the SMILES notation for S-(4-methylphenyl) propanethioate?
The canonical SMILES for S-(4-methylphenyl) propanethioate is CCC(=O)Sc1ccc(C)cc1.
What is the InChIKey of S-(4-methylphenyl) propanethioate?
The InChIKey is QCOJPGJASADAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-3-10(11)12-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3.
What are the key properties of S-(4-methylphenyl) propanethioate?
S-(4-methylphenyl) propanethioate has a molecular weight of 180.27 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) propanethioate is sourced from PubChem (CID 3870745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).